4-Fluoro-3-phenoxybenzoic acid is an agrochemical metabolite characterized by a carboxylic acid group, ether linkage, and an aromatic fluorine substituent. Its structure includes two aromatic rings and a halogen, contributing to its moderate lipophilicity and potential as a research reference standard.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 77279-89-1
Thiacloprid TP2
Agrochemical metabolite
(2E)-2-methoxyimino-2-[2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]acetic acid
Agrochemical metabolite
2-tert-butylimino-1-oxo-5-phenyl-3-propan-2-yl-1,3,5-thiadiazinan-4-one
Agrochemical metabolite
2-(2-methoxy-ethoxymethyl)-6-trifluoromethyl-nicotinic acid
Agrochemical metabolite
질산 칼륨
Pesticide active ingredient
황산 구리
Fungicide and pesticide ingredient
Copper sulfate pentahydrate
Fungicide and pesticide active ingredient
AMMONIUM SULFAMATE
broad spectrum herbicide
4-fluoro-3-phenoxybenzoic acid
VLXNXMTVRWIUJZ-UHFFFAOYSA-N
C1=CC=C(C=C1)OC2=C(C=CC(=C2)C(=O)O)F