This compound is a pyridine-based agrochemical metabolite, characterized by a carboxylic acid group and a trifluoromethyl substituent on the aromatic ring. It is primarily recognized as a degradation or transformation product of certain pesticides, and is used in environmental and residue analysis studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 380355-55-5
2-tert-butylimino-1-oxo-5-phenyl-3-propan-2-yl-1,3,5-thiadiazinan-4-one
Agrochemical metabolite
4-Fluoro-3-phenoxybenzoic acid
Agrochemical metabolite
Thiacloprid TP2
Agrochemical metabolite
(2E)-2-methoxyimino-2-[2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]acetic acid
Agrochemical metabolite
Streptomycin sulfate
antibiotic for bacterial infections
Omadine sodium
antifungal and antibacterial agent
Glyphosate-isopropylammonium
broad-spectrum post-emergence herbicide
Sodium chloroacetate
herbicide and defoliant manufacture
2-(2-methoxyethoxymethyl)-6-(trifluoromethyl)pyridine-3-carboxylic acid
OOHPBGRAQNINBY-UHFFFAOYSA-N
COCCOCC1=C(C=CC(=N1)C(F)(F)F)C(=O)O