Cyanomethyl N-methyl-N-phenylcarbamodithioate is a research reagent used primarily in chemical and pharmaceutical research settings. Its structure features an aromatic ring, an amine group, and a nitrile group, which contribute to its utility as a building block in synthetic chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Cyanomethyl N-methyl-N-phenylcarbamodithioate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Indole-2,4,5,6,7-d5-3-acetic acid
Deuterated biochemical research reagent
8-Bromo-cAMP sodium salt
research compound
2-Fluoro-4-methylbenzoic acid
research chemical intermediate
2-chloro-4-methylbenzoic acid
research compound
cyanomethyl N-methyl-N-phenylcarbamodithioate
FYACMHCOSCVNHO-UHFFFAOYSA-N
CN(C1=CC=CC=C1)C(=S)SCC#N
—
Cyanomethyl N-methyl-N-phenylcarbamodithioate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.