This compound is a deuterated derivative of indole-3-acetic acid, a naturally occurring auxin plant hormone. It is used as a stable isotope-labeled research reagent for biochemical and metabolic studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 76937-78-5
8-Bromo-cAMP sodium salt
research compound
2-Fluoro-4-methylbenzoic acid
research chemical intermediate
2-chloro-4-methylbenzoic acid
research compound
3-Bromo-4-methylbenzoic acid
synthetic intermediate for organic chemistry
Indole-3-acetic acid
plant growth hormone auxin
2-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)acetic acid
SEOVTRFCIGRIMH-SNOLXCFTSA-N
[2H]C1=C(C(=C2C(=C1[2H])C(=C(N2)[2H])CC(=O)O)[2H])[2H]