This compound is a deuterated derivative of indole-3-acetic acid, a naturally occurring auxin plant hormone. It is used as a stable isotope-labeled research reagent for biochemical and metabolic studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Indole-2,4,5,6,7-d5-3-acetic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
8-Bromo-cAMP sodium salt
research compound
2-Fluoro-4-methylbenzoic acid
research chemical intermediate
2-chloro-4-methylbenzoic acid
research compound
3-Bromo-4-methylbenzoic acid
synthetic intermediate for organic chemistry
Indole-3-acetic acid
plant growth hormone auxin
Indole-2,4,5,6,7-d5-3-acetic acid(CAS 76937-78-5)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
2-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)acetic acid
SEOVTRFCIGRIMH-SNOLXCFTSA-N
[2H]C1=C(C(=C2C(=C1[2H])C(=C(N2)[2H])CC(=O)O)[2H])[2H]
Indole-2,4,5,6,7-d5-3-acetic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.