This compound is a pharmaceutical intermediate featuring a complex heterocyclic structure with trifluoromethyl and trifluorophenyl substituents. It is primarily used in the synthesis of active pharmaceutical ingredients.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 764667-65-4
(Z)-3-(Hydroxyimino)-1-(3-(trifluoromethyl)-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl)-4-(2,4,5-trifluorophenyl)butan-1-one
nitrosamine standard
(2S,3R)-3-acetamido-2-hydroxy-4-phenylbutanoic acid
peptide building block for synthesis
2-METHYL-1,3-CYCLOPENTANEDIONE
Synthetic building block for natural products
Methyl 3,3-diphenyloxirane-2-carboxylate
Intermediate for ambrisentan synthesis
Tert-butyl Piperazine-1-carboxylate Hydrochloride
Pharmaceutical intermediate for drug synthesis
1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butane-1,3-dione
QAEDTLFWHIEVPK-UHFFFAOYSA-N
C1CN2C(=NN=C2C(F)(F)F)CN1C(=O)CC(=O)CC3=CC(=C(C=C3F)F)F