Methyl 3,3-diphenyloxirane-2-carboxylate is a chemical compound used as a pharmaceutical intermediate, specifically in the synthesis of ambrisentan. It is characterized by an epoxide ring and two aromatic rings, with an ester functional group.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 76527-25-8
Tert-butyl Piperazine-1-carboxylate Hydrochloride
Pharmaceutical intermediate for drug synthesis
5-Bromo-2-fluoropyridine
Pharmaceutical intermediate
6,6-Dibromopenicillanic acid sulfone
Pharmaceutical intermediate for beta-lactam derivatives
3-(piperidin-4-yl)benzoic acid
Pharmaceutical intermediate
methyl 3,3-diphenyloxirane-2-carboxylate
ILXKNKDKHCSQTL-UHFFFAOYSA-N
COC(=O)C1C(O1)(C2=CC=CC=C2)C3=CC=CC=C3