l-Alanine-d7 is an isotopically labeled form of the amino acid L-alanine, where seven hydrogen atoms are replaced by deuterium. It is primarily used as a research reagent in studies requiring a stable isotope-labeled internal standard, such as for analytical chemistry or metabolic tracing experiments.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
L-alanine-d7 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Urethane-d5 (ethyl-d5)
isotopically labeled research compound
Nitrobenzene-(1)(3)C
isotopically labeled research compound
2,4,6-Trichlorophen-3,5-d2-ol
isotopically labeled research compound
1,3,5-Tribromobenzene-d3
isotopically labeled research compound
Triptophenolide
research compound
2'-Deoxyadenosine 5'-(disodium dihydrogen triphosphate)
Nucleotide triphosphate research reagent
1,2-O-Isopropylidene-sn-glycerol-d5
deuterated research reagent
2-bromo-4-methoxybenzoic acid
research compound
deuterio (2S)-2,3,3,3-tetradeuterio-2-(dideuterioamino)propanoate
QNAYBMKLOCPYGJ-VQIVFXRSSA-N
[2H][C@@](C(=O)O[2H])(C([2H])([2H])[2H])N([2H])[2H]
L-alanine-d7 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.