Triptophenolide is a diterpenoid lactone compound used primarily as a research reagent. It features a tetracyclic ring system with an aromatic ring, ester, and ether functional groups, as indicated by its structure.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 74285-86-2
2'-Deoxyadenosine 5'-(disodium dihydrogen triphosphate)
Nucleotide triphosphate research reagent
1,2-O-Isopropylidene-sn-glycerol-d5
deuterated research reagent
2-bromo-4-methoxybenzoic acid
research compound
4-Hydroxy-7-azaindole
research compound
(3bR,9bS)-6-hydroxy-9b-methyl-7-propan-2-yl-3,3b,4,5,10,11-hexahydronaphtho[2,1-e][2]benzofuran-1-one
KPXIBWGPZSPABK-FXAWDEMLSA-N
CC(C)C1=C(C2=C(C=C1)[C@]3(CCC4=C([C@@H]3CC2)COC4=O)C)O