2,4,6-Trichlorobenzeneboronic acid is a boronic acid compound containing three chlorine substituents on an aromatic ring. It is primarily used as a research reagent in organic synthesis, particularly in cross-coupling reactions and the preparation of other boron-containing molecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,4,6-Trichlorobenzeneboronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2,6-Diisopropylphenylboronic acid
boronic acid research compound
2-boronothiophene-3-carboxylic Acid
boronic acid research compound
(6-isopropyldibenzo[b,d]furan-4-yl)boronic acid
boronic acid research compound
2-pyrrolidinylphosphonic acid
research compound
2',3',5'-Tri-O-acetyladenosine
Nucleoside research intermediate
(1S)-1-(4-Chlorophenyl)propan-1-ol
research compound for chiral synthesis
4-(Dimethylamino)phenyldiphenylphosphine
Phosphine ligand for cross-coupling reactions
(2,4,6-trichlorophenyl)boronic acid
JWWBOINZBOIAHR-UHFFFAOYSA-N
B(C1=C(C=C(C=C1Cl)Cl)Cl)(O)O
—
2,4,6-Trichlorobenzeneboronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.