2,6-Diisopropylphenylboronic acid is a boronic acid compound used primarily in research. It features a diisopropyl-substituted aromatic ring and a boronic acid functional group, with properties including two hydrogen bond donors and a molecular weight of approximately 206 g/mol.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 363166-79-4
2-boronothiophene-3-carboxylic Acid
boronic acid research compound
2,4,6-Trichlorobenzeneboronic acid
boronic acid research compound
(6-isopropyldibenzo[b,d]furan-4-yl)boronic acid
boronic acid research compound
3,3-difluoropiperidine
research compound
2-Fluoronicotinamide
research compound
1-(Diphenylmethyl)azetidine-3-carboxylic acid
Research compound
Triethylcholine hydroxide
structure-directing agent for synthesis
[2,6-di(propan-2-yl)phenyl]boronic acid
UPXGMXMTUMCLGD-UHFFFAOYSA-N
B(C1=C(C=CC=C1C(C)C)C(C)C)(O)O
—