This compound is a deuterated derivative of iodobenzene, where five hydrogen atoms on the aromatic ring are replaced with deuterium. It is used as a pharmaceutical intermediate, primarily in research and manufacturing settings for the synthesis of labeled compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 7379-67-1
3-azabicyclo[3.1.0]hexane hydrochloride
pharmaceutical intermediate
Bergamottin
pharmaceutical reference impurity standard
Boc-Asp(OcHx)-OH
protected amino acid for peptide synthesis
5-Cyclohexyl hydrogen N-[(1,1-dimethylethoxy)carbonyl]-L-glutamate
Pharmaceutical intermediate for peptide synthesis
Phenyl iodide
Chemical reagent for organic synthesis
1,2,3,4,5-pentadeuterio-6-iodobenzene
SNHMUERNLJLMHN-RALIUCGRSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])I)[2H])[2H]