This compound is a protected glutamic acid derivative featuring a tert-butyloxycarbonyl (Boc) protecting group and cyclohexyl ester moieties. It is primarily used as a pharmaceutical intermediate in peptide synthesis, particularly for the introduction of glutamic acid residues with orthogonal protection.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 73821-97-3
Boc-Asp(OcHx)-OH
protected amino acid for peptide synthesis
Acotiamide Impurity 36
pharmaceutical impurity reference standard
1,15-diethyl 2,2,14,14-tetramethyl-8-oxopentadecanedioate
pharmaceutical intermediate
5-(2-bromoacetyl)-2-hydroxybenzamide
Pharmaceutical intermediate
(4R)-5-(tert-butoxy)-4-{[(tert-butoxy)carbonyl]amino}-5-oxopentanoic acid
peptide synthesis intermediate
Boc-D-Glu(Ochex)-Oh
Protected amino acid for peptide synthesis
(2S)-5-cyclohexyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid
FDNMLANBNJDIRG-LBPRGKRZSA-N
CC(C)(C)OC(=O)N[C@@H](CCC(=O)OC1CCCCC1)C(=O)O