(2R)-6-oxopiperidine-2-carboxylic acid is a research compound featuring a piperidine ring with a ketone and a carboxylic acid group. It is primarily used as a laboratory reagent for chemical and biochemical studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(2R)-6-oxopiperidine-2-carboxylic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
L-Pyroglutamic acid
food additive and antioxidant
DdATP trisodium
Nucleotide analog research reagent
6-[5-(2-OXO-HEXAHYDRO-THIENO[3,4-D]IMIDAZOL-4-YL)-PENTANOYLAMINO]-HEXANOIC ACID
biotinylation reagent for protein labeling
3',6'-dihydroxy-3-oxospiro[isobenzofuran-1(3H),9'-[9H]xanthene]-ar-carboxylic acid
fluorescent dye tracer
3-Chloro-4-methylpyridine
research compound
(S)-6-Oxo-2-piperidinecarboxylic acid
pharmaceutical intermediate
6-Oxopiperidine-2-carboxylic acid
Bacterial metabolite research compound
T-Boc-amino-2-piperidone
intermediate in peptide analog synthesis
(2R)-6-oxopiperidine-2-carboxylic acid
FZXCPFJMYOQZCA-SCSAIBSYSA-N
C1C[C@@H](NC(=O)C1)C(=O)O
(2R)-6-oxopiperidine-2-carboxylic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.