This compound is a deuterium-labeled form of 4-aminobutanoic acid, specifically hexadeuterated at the carbon positions. It is primarily used as a stable isotope labeled analytical standard in research and laboratory settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-Aminobutyric acid-2,2,3,3,4,4-d6 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Epsilon-Aminocaproic Acid-d10 Hydrochloride
research reagent for pharmacokinetic studies
3-((E)-((2-nitrophenyl)methylidene)amino)(2H4)-1,3-oxazolidin-2-one
stable isotope labeled analytical standard
Deschloroketamine
research compound
(S)-benzyl 2-((S)-2-amino-4-methylpentanamido)-3-phenylpropanoate 2,2,2-trifluoroacetate
research compound
3,3-dimethylbutanoyl chloride
research compound
1,3,5-tribromoadamantane
reference standard for impurity analysis
감마 아미노뷰티르산
active pharmaceutical ingredient
4-amino-2,2,3,3,4,4-hexadeuteriobutanoic acid
BTCSSZJGUNDROE-NMFSSPJFSA-N
[2H]C([2H])(C(=O)O)C([2H])([2H])C([2H])([2H])N
4-Aminobutyric acid-2,2,3,3,4,4-d6 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.