This compound is a stable isotope-labeled analytical standard, specifically a deuterated form of a nitrophenyl-substituted oxazolidinone derivative. It is primarily used in research settings as a reference material for quantitative analysis, leveraging its isotopic labeling for mass spectrometry and other detection methods.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-Aminobutyric acid-2,2,3,3,4,4-d6
stable isotope labeled analytical standard
5-BROMOINDOLE
research compound
1,3-dimethoxynaphthalene
research compound
9,10-Bis(phenylethynyl)anthracene
chemiluminescent fluorophore with high quantum efficiency
Tert-butyl (2S)-2-(1H-imidazol-2-yl)pyrrolidine-1-carboxylate
Research compound for medicinal chemistry
2-Oxazolidone, 3-(o-nitrobenzylideneamino)-
n.a
4,4,5,5-tetradeuterio-3-[(E)-(2-nitrophenyl)methylideneamino]-1,3-oxazolidin-2-one
OHYXOGZWSSNLON-XMKBWRBRSA-N
[2H]C1(C(OC(=O)N1/N=C/C2=CC=CC=C2[N+](=O)[O-])([2H])[2H])[2H]
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.