4,6-Dichloronicotinamide is a chemical compound that is a chlorinated derivative of nicotinamide. It is primarily used as a research reagent in laboratory settings for chemical synthesis and development studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4,6-Dichloronicotinamide 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-PYRROLIDINONE-3,3,4,4,5,5-D6
Deuterated research compound
4-Aminobutyric acid-2,2,3,3,4,4-d6
stable isotope labeled analytical standard
Deschloroketamine
research compound
(S)-benzyl 2-((S)-2-amino-4-methylpentanamido)-3-phenylpropanoate 2,2,2-trifluoroacetate
research compound
4,6-dichloropyridine-3-carboxamide
IQVYHPUXNYVYFW-UHFFFAOYSA-N
C1=C(C(=CN=C1Cl)C(=O)N)Cl
4,6-Dichloronicotinamide 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.