This compound is a chemical compound used as a pharmaceutical intermediate. It is primarily significant for the synthesis of floxacrine analogues in research and manufacturing settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 69399-79-7
3-(2,6-Dichlorophenyl)-5-methylisoxazole-4-carbonyl chloride
pharmaceutical intermediate
2-Acetyl-6-methylpyridine
pharmaceutical intermediate
4-Amino-2-fluorobenzotrifluoride
Pharmaceutical intermediate
Rel-1,1-Dimethylethyl (4aR,7aS)-hexahydro-6H-1,4-dioxino[2,3-c]pyrrole-6-carboxylate
Pharmaceutical intermediate for API synthesis
Benzenamine, 4-[(4-methyl-1-piperazinyl)methyl]-3-(trifluoromethyl)-
Pharmaceutical intermediate
3-(2-Chlorophenyl)-5-methylisoxazole-4-carbonyl chloride
Pharmaceutical intermediate for drug synthesis
5-Methyl-3-phenylisoxazole-4-carbonyl chloride
pharmaceutical intermediate
Ethyl 5-(hydroxymethyl)-3-phenylisoxazole-4-carboxylate
research compound
3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride
XJCUKCOLGJDGGN-UHFFFAOYSA-N
CC1=C(C(=NO1)C2=C(C=CC=C2Cl)F)C(=O)Cl