This compound is a pharmaceutical intermediate featuring a piperazine ring and a trifluoromethyl-substituted aniline moiety. It is primarily used in the synthesis of other pharmaceutical compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 694499-26-8
Ethyl hydrazinoacetate hydrochloride
Pharmaceutical intermediate for drug synthesis
(-)-Isopinocampheylamine
Pharmaceutical intermediate
3'-Chloro-4'-aminoacetophenone
Pharmaceutical intermediate for synthesis
Ethyl 2-(diphenylmethyleneamino)acetate
Pharmaceutical intermediate for glycine derivatives
1-Nitroso-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine
nitrosamine impurity standard
4-[(4-methylpiperazin-1-yl)methyl]benzoic Acid Dihydrochloride
pharmaceutical intermediate
4-[(4-methyl-1-piperazinyl)methyl]benzoyl chloride dihydrochloride
pharmaceutical intermediate
4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)aniline
ZMWAZMYBMAAMAW-UHFFFAOYSA-N
CN1CCN(CC1)CC2=C(C=C(C=C2)N)C(F)(F)F