1,3-Bis(diphenylphosphino)propane is a bidentate phosphine ligand used in organometallic chemistry. It coordinates to transition metals to form stable complexes, playing a key role in homogeneous catalysis and coordination chemistry research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1,3-Bis(diphenylphosphino)propane 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Dichloro(1,1'-(1,3-propanediyl)bis(1,1-diphenylphosphine-kappaP))nickel
catalyst for organic synthesis
(1,3-Bis(diphenylphosphino)propane)palladium(II) chloride
catalyst for cross-coupling reactions
1,4-Bis(diphenylphosphino)butane
bidentate phosphine ligand
1,6-Bis(diphenylphosphino)hexane
bidentate phosphine ligand for catalysis
1,5-Bis(diphenylphosphino)pentane
organophosphorus ligand for coordination chemistry
(Octane-1,8-diyl)bis(diphenylphosphane)
Bidentate phosphine ligand
Decarboxylated S-Adenosylmethionine Sulfate Salt
research compound
Dichlorohexamethylbenzene ruthenium(II) dimer
research reagent for organometallic chemistry
3-diphenylphosphanylpropyl(diphenyl)phosphane
LVEYOSJUKRVCCF-UHFFFAOYSA-N
C1=CC=C(C=C1)P(CCCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4
1,3-Bis(diphenylphosphino)propane 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.