1,6-Bis(diphenylphosphino)hexane is a bidentate phosphine ligand commonly employed in homogeneous catalysis. Its structure features two diphenylphosphino groups linked by a hexamethylene chain, enabling it to coordinate to metal centers and influence catalytic activity.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1,6-Bis(diphenylphosphino)hexane 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1,5-Bis(diphenylphosphino)pentane
organophosphorus ligand for coordination chemistry
(Octane-1,8-diyl)bis(diphenylphosphane)
Bidentate phosphine ligand
(1,4-BIS(DIPHENYLPHOSPHANYL)BUTANE)DICHLORIDOPLATINUM(II)
Organometallic research reagent
1,4-Bis(diphenylphosphino)butane
bidentate phosphine ligand
(R)-7-(Benzyloxy)-3,4,12,12a-tetrahydro-1H-[1,4]oxazino[3,4-c]pyrido[2,1-f][1,2,4]triazine-6,8-dione
Research reagent
FMOC-PHE(4-BR)-OH
Research compound for peptide synthesis
Nicotinamide N-oxide
research compound for crystal engineering
HIV (gp120) Antigenic Peptide trifluoroacetate salt
HIV antigenic peptide reagent
6-diphenylphosphanylhexyl(diphenyl)phosphane
GPORFKPYXATYNX-UHFFFAOYSA-N
C1=CC=C(C=C1)P(CCCCCCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4
—
1,6-Bis(diphenylphosphino)hexane 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.