3-Deazaadenosine is a research compound used for adenosine receptor studies. It is a structural analog of adenosine where the nitrogen atom at position 3 of the purine ring is replaced by carbon, and it features a ribose sugar moiety with multiple hydroxyl groups.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 6736-58-9
N6-Benzyl-5'-ethylcarboxamido Adenosine
Research compound for adenosine receptor studies
Methyl 2-methoxypyridine-3-carboxylate
Positron emission tomography radiotracer
1,3-Bis(diphenylphosphino)propane
Bidentate phosphine ligand for metal complexes
Decarboxylated S-Adenosylmethionine Sulfate Salt
research compound
Dichlorohexamethylbenzene ruthenium(II) dimer
research reagent for organometallic chemistry
4-Amino-6-chloro-1-b-D-ribofuranosylimidazo[4,5-c]pyridine
Pharmaceutical intermediate and research compound
(2R,3R,4S,5R)-2-(4-aminoimidazo[4,5-c]pyridin-1-yl)-5-(hydroxymethyl)oxolane-3,4-diol
DBZQFUNLCALWDY-PNHWDRBUSA-N
C1=CN=C(C2=C1N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N