Ethyl Pyruvate-3,3,3-d3 is a deuterated research compound labeled with three deuterium atoms at the methyl group. It is primarily used as a stable isotope internal standard in analytical chemistry and metabolic studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 66966-38-9
2-PYRROLIDINONE-3,3,4,4,5,5-D6
Deuterated research compound
2-BROMOPYRIDINE-D4
Deuterated research compound
4-Bromobenzoic-d4 Acid
Deuterated research compound
2-Hydroxy Estrone-d4
Deuterated research compound
(9H-Fluoren-9-yl)methyl 2-(aminomethyl)piperidine-1-carboxylate--hydrogen chloride (1/1)
research compound
3-Aminomethyl-1-N-Fmoc-piperidine hydrochloride
Research reagent for peptide synthesis
4-(1-(tert-butoxycarbonyl)-1H-pyrrol-2-yl)benzoic acid
research compound
4,6-dibromodibenzothiophene
research compound for binuclear platinum complexes
ethyl 3,3,3-trideuterio-2-oxopropanoate
XXRCUYVCPSWGCC-BMSJAHLVSA-N
[2H]C([2H])([2H])C(=O)C(=O)OCC