2-Bromopyridine-d4 is a deuterated research compound where all four hydrogen atoms on the pyridine ring are replaced by deuterium. It is primarily used as a labeled internal standard or tracer in analytical chemistry and pharmaceutical research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 70766-71-1
1-BROMOHEPTANE-D15
Deuterated research compound
4-Bromobenzoic-d4 Acid
Deuterated research compound
2-Hydroxy Estrone-d4
Deuterated research compound
Tri(pentadeuterophenyl)amine
Deuterated research compound
2-Hydroxy-1-naphthaldehyde
research compound
(+/-)-Mandelic-2,3,4,5,6-d5 Acid
deuterated research reference standard
Naloxone 3-Methyl Ether
research compound
(2,3-dihydrobenzo[b][1,4]dioxin-2-yl)(piperazin-1-yl)methanone
Research compound
2-bromo-3,4,5,6-tetradeuteriopyridine
IMRWILPUOVGIMU-RHQRLBAQSA-N
[2H]C1=C(C(=NC(=C1[2H])Br)[2H])[2H]