This compound is a highly deuterated alkyl thiol used as a research reagent. Its structure consists of a fully deuterated octadecane chain with a terminal thiol group, making it valuable for stable isotope labeling studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1-OCTADECANE-D37-THIOL 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-OCTANE-D17-THIOL
deuterated research reference standard
DIBENZOTHIOPHENE-2-BORONIC ACID
Organic synthesis building block
Difluoromaleic anhydride
research compound
Ethyl Pyruvate-3,3,3-d3
Deuterated research compound
(9H-Fluoren-9-yl)methyl 2-(aminomethyl)piperidine-1-carboxylate--hydrogen chloride (1/1)
research compound
1-OCTADECANETHIOL
Pharmaceutical intermediate
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,18-heptatriacontadeuteriooctadecane-1-thiol
QJAOYSPHSNGHNC-UQCHHHBTSA-N
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])S
1-OCTADECANE-D37-THIOL 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.