2,6-Dichlorophenylacetic acid is a chlorinated aromatic carboxylic acid used as a research reagent in organic synthesis. Its structure features a dichlorophenyl ring attached to an acetic acid moiety, contributing to its utility as a building block for further chemical transformations.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 6575-24-2
2-Fluoro-3-(trifluoromethyl)pyridine
research compound
5-Bromo-4-chloro-3-indolyl phosphate p-toluidine salt
Biochemical staining reagent
2,6-Dichlorobenzenesulfonyl chloride
chemical reagent for organic synthesis
4-(Trifluoromethoxy)benzyl Chloride
research compound
2-(2,6-dichlorophenyl)acetic acid
SFAILOOQFZNOAU-UHFFFAOYSA-N
C1=CC(=C(C(=C1)Cl)CC(=O)O)Cl