This compound is a protected amino acid derivative used as an intermediate in peptide synthesis. It features a tert-butyloxycarbonyl (BOC) protecting group on the amino nitrogen and a benzyloxycarbonyl (Z) protecting group on the side chain, enabling selective deprotection during solid-phase or solution-phase peptide assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
BOC-DAP(Z)-OH 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
L-N-Cbz-3-N-Boc-Amino-alanine
pharmaceutical intermediate
(2S)-5-{[(benzyloxy)carbonyl]amino}-2-{[(tert-butoxy)carbonyl]amino}pentanoic acid
protected amino acid building block
(2R)-2-{[(benzyloxy)carbonyl]amino}butanedioic acid
Peptide synthesis intermediate
Boc-D-Asp(OBzl)-OH
Peptide synthesis intermediate
Z-glu-otbu
Peptide synthesis intermediate
Fmoc-L-valine
Peptide synthesis intermediate
(2S)-pyrrolidine-2-carbonitrile hydrochloride
Pharmaceutical intermediate for API synthesis
6-Chloro-N-methylpyrimidin-4-amine
pharmaceutical intermediate
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(phenylmethoxycarbonylamino)propanoic acid
QKMSMVGTLTVHLK-LBPRGKRZSA-N
CC(C)(C)OC(=O)N[C@@H](CNC(=O)OCC1=CC=CC=C1)C(=O)O
BOC-DAP(Z)-OH 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.