This compound is an N-protected glutamic acid derivative used as a building block in solid-phase or solution-phase peptide synthesis. It features both a benzyloxycarbonyl (Cbz) protecting group on the amino terminus and a tert-butyl ester protecting group on the side-chain carboxyl, enabling selective deprotection during peptide chain assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Z-glu-otbu 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
5-benzyl 1-(tert-butyl) ((benzyloxy)carbonyl)-L-glutamate
Protected glutamic acid derivative
N-alpha-t-Butyloxycarbonyl-D-glutamic acid benzyl ester
Pharmaceutical intermediate for peptide synthesis
(4S)-5-(benzyloxy)-4-{[(benzyloxy)carbonyl]amino}-5-oxopentanoic acid
pharmaceutical intermediate for peptide synthesis
5-tert-Butyl N-((phenylmethoxy)carbonyl)-L-glutamate
Protected amino acid for peptide synthesis
BOC-DAP(Z)-OH
Peptide synthesis intermediate
(2R)-2-{[(benzyloxy)carbonyl]amino}butanedioic acid
Peptide synthesis intermediate
Boc-D-Asp(OBzl)-OH
Peptide synthesis intermediate
Fmoc-Glu(OtBu)-Phe-OH
Peptide synthesis intermediate
(4S)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid
VJECGKAFPHEJQS-ZDUSSCGKSA-N
CC(C)(C)OC(=O)[C@H](CCC(=O)O)NC(=O)OCC1=CC=CC=C1
Z-glu-otbu 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.