2,3,5,6-Tetrafluoroterephthalic acid is a fluorinated aromatic dicarboxylic acid used as an industrial chemical intermediate. Its structure features a benzene ring substituted with four fluorine atoms and two carboxylic acid groups, making it a building block for specialty polymers and other advanced materials.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 652-36-8
Pentafluorobenzoic acid
Synthetic polymer MALDI matrix compound
Tetrafluoro-4-hydroxybenzoic acid
Organic synthesis intermediate
4-(trans-4-n-Propylcyclohexyl)benzoic acid
Liquid crystal intermediate
2,6-Dimethylhydroquinone
hydroquinone derivative intermediate
4-Nitro-2-(trifluoromethyl)anisole
chemical intermediate for synthesis
1,8-DIMETHYL-9H-CARBAZOLE
Electronic chemical intermediate
2,3,5,6-tetrafluoroterephthalic acid
WFNRNCNCXRGUKN-UHFFFAOYSA-N
C1(=C(C(=C(C(=C1F)F)C(=O)O)F)F)C(=O)O