1,8-Dimethyl-9H-carbazole is an organic compound used primarily as an electronic chemical intermediate. Its structure features a carbazole core with methyl substituents at the 1 and 8 positions, contributing to its application in the synthesis of materials for electronic devices.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1,8-DIMETHYL-9H-CARBAZOLE 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-fluorophthalonitrile
synthetic intermediate for specialty chemicals
2,4-Dichlorobenzonitrile
chemical intermediate for agrochemicals
2-Chloro-3-(trifluoromethyl)pyridine
chemical synthesis intermediate
Dicyclopentenyloxyethyl acrylate
acrylic monomer for polymers
1,8-dimethyl-9H-carbazole
NAXSBBMMIDFGHQ-UHFFFAOYSA-N
CC1=C2C(=CC=C1)C3=CC=CC(=C3N2)C
1,8-DIMETHYL-9H-CARBAZOLE 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.