Testosterone sulfate is a steroid sulfate derivative of testosterone, featuring a sulfoxy group at the 17-position. It is recognized as a naturally occurring human urinary metabolite and is utilized in research related to metabolic studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 651-45-6
4-Hydroxycyclohexanecarboxylic acid
human urinary metabolite research
Glycine, L-cysteinyl-L-asparaginylglycyl-L-arginyl-L-cysteinyl-
research compound
2-Bromo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
cross-coupling reagent for synthesis
H-Gly-Arg-AMC
fluorogenic enzyme substrate for peptidase assay
6-bromoquinoline-2-carboxylic acid
research compound
[(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] hydrogen sulfate
WAQBISPOEAOCOG-DYKIIFRCSA-N
C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OS(=O)(=O)O)CCC4=CC(=O)CC[C@]34C