6-Bromoquinoline-2-carboxylic acid is a research compound that features a quinoline core substituted with a bromine atom and a carboxylic acid group. It is primarily used as a laboratory reagent in chemical synthesis and development studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
6-bromoquinoline-2-carboxylic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
6-Bromoquinoline-2-carbonitrile
research compound
1-ethyl-1H-1,2,3,4-tetrazol-5-amine
research compound for fentanyl analogue studies
(3R,4S)-4-PHENYLPYRROLIDINE-3-CARBOXYLIC ACID
research compound
(13C)-Methane
isotopically labeled research reagent
6-bromoquinoline-2-carboxylic acid
UQGCFISFRKCLOL-UHFFFAOYSA-N
C1=CC2=C(C=CC(=N2)C(=O)O)C=C1Br
6-bromoquinoline-2-carboxylic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.