Dimetridazole D3 is a stable isotope labeled reference standard used in analytical research. It is the trideuteriomethyl analog of dimetridazole, a nitroimidazole compound employed as a marker for quantitation in mass spectrometry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 64678-69-9
4H-Imidazol-4-one, 2-amino-1,5-dihydro-1-(methyl-d3)-
stable isotope labeled reference standard
Leucomalachite Green-d6
stable isotope labeled reference standard
L-Tyrosine-13C6
stable isotope labeled reference standard
Stearoyl-L-carnitine-d3 (chloride)
stable isotope labeled reference standard
2-Bromo-4,5-difluorobenzonitrile
Research compound
2-Bromo-4,5-difluorobenzoic acid
chemical synthesis intermediate
Triisopropylphosphine
Ligand in organometallic chemistry
3,4-Dimethoxyamphetamine, (R)-
research compound
2-methyl-5-nitro-1-(trideuteriomethyl)imidazole
IBXPYPUJPLLOIN-BMSJAHLVSA-N
[2H]C([2H])([2H])N1C(=NC=C1[N+](=O)[O-])C