3-Nitrophthalic anhydride is an organic compound that serves as a key intermediate in the synthesis of pharmaceuticals and fine chemicals. It is characterized by a nitro-substituted phthalic anhydride structure, making it valuable for constructing complex molecular architectures.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 641-70-3
Di-(2-ethylhexyl) terephthalate
Plasticizer for PVC and rubbers
1,2-difluoro-3-(trifluoromethyl)benzene
Industrial chemical intermediate
Sodium isooctadecanoate
surfactant and emulsifier ingredient
Morpholine, 4,4'-(oxydi-2,1-ethanediyl)bis-
Blowing agent for polyurethane foams
TETRACHLOROPHTHALIC ANHYDRIDE
flame retardant and chemical intermediate
3-Chlorophthalic anhydride
Pharmaceutical intermediate for synthesis
4-Chlorophthalic anhydride
Chemical intermediate for dyes and pigments
Trimellitic anhydride chloride
Pharmaceutical intermediate
4-nitro-2-benzofuran-1,3-dione
ROFZMKDROVBLNY-UHFFFAOYSA-N
C1=CC2=C(C(=C1)[N+](=O)[O-])C(=O)OC2=O