1,2-Difluoro-3-(trifluoromethyl)benzene is a fluorinated aromatic compound containing five fluorine atoms. It is primarily used as an industrial chemical intermediate in the synthesis of more complex organic molecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 64248-59-5
Sodium isooctadecanoate
surfactant and emulsifier ingredient
Morpholine, 4,4'-(oxydi-2,1-ethanediyl)bis-
Blowing agent for polyurethane foams
Trimethylolpropane tris(2-methyl-1-aziridinepropionate)
crosslinking agent for coatings
O-Phthalaldehyde
reagent for amino acid analysis
1,2-difluoro-3-(trifluoromethyl)benzene
CBOJZWDLNLMBLM-UHFFFAOYSA-N
C1=CC(=C(C(=C1)F)F)C(F)(F)F