L-Alanine-3,3,3-d3 is a deuterium-labeled analogue of the amino acid alanine, used primarily as an internal standard in analytical chemistry and mass spectrometry. Its isotopic labeling allows precise quantification in metabolic and proteomic research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
L-Alanine-3,3,3-d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2,3-dimethyl-6-amino-2H-indazole hydrochloride
research compound
Gamma-glutamylcysteine
research compound
3-Pyridinesulfonic acid
research compound
1-Iodo-4-nitrobenzene
research reagent
L-alanine-d7
isotopically labeled research compound
L-Alanine-d4
deuterated analytical reference standard
DL-ALANINE
flavoring agent or adjuvant
D-alanine
biochemical research reagent
L-Alanine-3,3,3-d3(CAS 63546-27-0)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
(2S)-2-amino-3,3,3-trideuteriopropanoic acid
QNAYBMKLOCPYGJ-VGCLAIIRSA-N
[2H]C([2H])([2H])[C@@H](C(=O)O)N
L-Alanine-3,3,3-d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.