N-Boc-L-tert-Leucine is an amino acid derivative used as a building block in peptide synthesis. It features a tert-butyloxycarbonyl (Boc) protecting group, which is commonly employed to shield the amino group during solid-phase or solution-phase peptide assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
N-Boc-L-tert-Leucine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Fmoc-His(Boc)-OH
amino acid derivative for peptide synthesis
Methyl 4-oxocyclohexanecarboxylate
Pharmaceutical intermediate
4-Pyridineethanethiol Hydrochloride
Pharmaceutical intermediate
Methyl 2,4-dichloropyrimidine-6-carboxylate
Pharmaceutical intermediate
Androstenedione
steroid hormone intermediate
(2R)-2-{[(tert-butoxy)carbonyl]amino}-3,3-dimethylbutanoic acid
Protected amino acid for peptide synthesis
(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid
LRFZIPCTFBPFLX-SSDOTTSWSA-N
CC(C)(C)[C@@H](C(=O)O)NC(=O)OC(C)(C)C
N-Boc-L-tert-Leucine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.