This compound is a protected amino acid derivative, specifically a tert-butoxycarbonyl (Boc)-protected form of D-tert-butylglycine. It is primarily used as a building block in peptide synthesis, where the protecting groups facilitate controlled formation of peptide bonds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-methylazetidin-3-ol Hydrochloride
pharmaceutical intermediate
(1S,4R)-4-(2-Amino-6-chloro-9H-purin-9-yl)-2-cyclopentene-1-carboxylate
Impurity of abacavir synthesis
2-(4-ethylphenyl)-2-methylpropanoic acid
Pharmaceutical intermediate
5-(4'-(Bromomethyl)(1,1'-biphenyl)-2-yl)-1-trityl-1h-tetraazole
pharmaceutical intermediate
N-Boc-L-tert-Leucine
amino acid derivative for peptide synthesis
(2R)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid
LRFZIPCTFBPFLX-ZETCQYMHSA-N
CC(C)(C)[C@H](C(=O)O)NC(=O)OC(C)(C)C
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.