3-Acetamidophthalic anhydride, also known as This compound, is a chemical compound used as a pharmaceutical intermediate in drug manufacturing. It features an amide group and a fused aromatic ring system with ester functionalities, contributing to its role in synthetic chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 6296-53-3
Butanedioic acid, 2,3-dihydroxy-, bis(1-methylethyl) ester, (2S,3S)-
chiral building block for synthesis
N-Boc-L-tert-Leucine
amino acid derivative for peptide synthesis
Methyl 4-oxocyclohexanecarboxylate
Pharmaceutical intermediate
4-Pyridineethanethiol Hydrochloride
Pharmaceutical intermediate
Tetrabromophthalic anhydride
reactive flame retardant
3-Chlorophthalic anhydride
Pharmaceutical intermediate for synthesis
Trimellitic anhydride chloride
Pharmaceutical intermediate
3-Iodophthalic anhydride
research compound
N-(1,3-dioxo-2-benzofuran-4-yl)acetamide
PAUAJOABXCGLCN-UHFFFAOYSA-N
CC(=O)NC1=CC=CC2=C1C(=O)OC2=O