4-나이트로벤조산
4-Nitrobenzoic acid is a pale yellow organic solid used as an intermediate in the production of pharmaceuticals and dyes. It serves as a precursor to 4-nitrobenzoyl chloride, which is further utilized in the synthesis of compounds such as the anesthetic procaine and folic acid.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 62-23-7
4-CHLOROBENZOTRICHLORIDE
Intermediate for pharmaceuticals and dyes
3-Chlorobenzyl chloride
synthetic intermediate for pharmaceuticals
N-Cbz-(2R,3R)-3-amino-2-hydroxy-4-phenylbutyric acid
pharmaceutical intermediate
(2S,3S)-3-(Z-amino)-2-hydroxy-4-phenylbutyric acid
protected amino acid intermediate
(2R,3R)-3-amino-2-hydroxy-4-phenylbutanoic acid
Impurity standard for ubenimex
4-Nitrobenzoic Acid-d4
isotope labeled research compound
4-nitrobenzoic acid
OTLNPYWUJOZPPA-UHFFFAOYSA-N
C1=CC(=CC=C1C(=O)O)[N+](=O)[O-]