This compound is a protected beta-amino acid derivative used as a pharmaceutical intermediate. It features a stereochemically defined structure with hydroxyl and carboxybenzyl (Cbz) protecting groups, making it valuable for peptide synthesis and medicinal chemistry research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
N-Cbz-(2R,3R)-3-amino-2-hydroxy-4-phenylbutyric acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(2R,3R)-3-amino-2-hydroxy-4-phenylbutanoic acid
Impurity standard for ubenimex
(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoic acid
Pharmaceutical intermediate for impurity studies
Benzenebutanoic acid, beta-amino-alpha-hydroxy-, (R*,S*)-
Impurity reference standard
(2S,3R)-3-((tert-Butoxycarbonyl)amino)-2-hydroxy-4-phenylbutanoic acid
Boc-protected amino acid intermediate
(2S,3S)-3-(Z-amino)-2-hydroxy-4-phenylbutyric acid
protected amino acid intermediate
3-BENZYLOXYCARBONYLAMINO-2-HYDROXY-4-PHENYL-BUTYRIC ACID
research compound for impurity studies
(2S,3R)-3-(((Benzyloxy)carbonyl)amino)-2-hydroxy-4-phenylbutanoic acid
research compound
Carbobenzoxyphenylalanine
protected amino acid for peptide synthesis
(2R,3R)-2-hydroxy-4-phenyl-3-(phenylmethoxycarbonylamino)butanoic acid
JXJYTERRLRAUSF-HZPDHXFCSA-N
C1=CC=C(C=C1)C[C@H]([C@H](C(=O)O)O)NC(=O)OCC2=CC=CC=C2
N-Cbz-(2R,3R)-3-amino-2-hydroxy-4-phenylbutyric acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.