This compound is a deuterated analytical reference standard of pregnenolone, a steroid hormone precursor. It is specifically labeled with four deuterium atoms at the 17alpha, 21, 21, and 21 positions, making it suitable for use as an internal standard in quantitative mass spectrometry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
PREGNENOLONE-17ALPHA,21,21,21-D4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Triphenylselenonium chloride
research compound
4-Amino-2-methylbenzaldehyde
research compound
1,2-Diarachidoyl-sn-glycero-3-phosphocholine
phospholipid research reference standard
5-Formylsalicylic acid
synthetic polymer MALDI matrix compound
Pregnenolone
precursor to steroid hormones
5-ANDROSTEN-3BETA,17BETA-DIOL-16,16,17-D3
isotopically labeled research standard
17a-Hydroxypregnenolone-d3
Deuterated steroid research compound
(3S,8R,9S,10R,13S,14S)-17,17-diiodo-10,13-dimethyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol
Abiraterone impurity reference standard
2,2,2-trideuterio-1-[(3S,8S,9S,10R,13S,14S,17S)-17-deuterio-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone
ORNBQBCIOKFOEO-QVFJSNPXSA-N
[2H][C@@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C)C(=O)C([2H])([2H])[2H]
PREGNENOLONE-17ALPHA,21,21,21-D4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.