3,4-Dihydroxyphenylacetic Acid-d5 is a deuterium-labeled analog of 3,4-dihydroxyphenylacetic acid, used as an isotopically labeled research reference standard. It is characterized by five deuterium atoms incorporated at specific positions on the aromatic ring and the acetic acid side chain.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 60696-39-1
Dodecanoic-d23 acid
isotopically labeled research reference standard
Monoethyl Phthalate-d4
isotopically labeled research reference standard
Ethyldiphenylphosphine
organophosphine ligand for coordination chemistry
2-Nitro-1-naphthol
research compound
2,4-dichloroquinazoline
research compound
2-chloro-3,4-dihydroquinazolin-4-one
research compound
3,4-Dihydroxyphenylacetic acid
research compound for dopamine metabolism
2,2-dideuterio-2-(2,3,6-trideuterio-4,5-dihydroxyphenyl)acetic acid
CFFZDZCDUFSOFZ-QUWGTZMWSA-N
[2H]C1=C(C(=C(C(=C1C([2H])([2H])C(=O)O)[2H])O)O)[2H]
—