Monoethyl Phthalate-d4 is a deuterium-labeled research reference standard used in analytical chemistry and environmental testing. It is the isotopically substituted form of monoethyl phthalate, with four hydrogen atoms replaced by deuterium, making it valuable for quantification and tracing studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1219806-03-7
1,2-Benzene-3,4,5,6-d4-dicarboxylic acid, diethyl ester
deuterated analytical reference standard
Dodecanoic-d23 acid
isotopically labeled research reference standard
3,4-Dihydroxyphenylacetic Acid-d5
isotopically labeled research reference standard
9-Amino-1,2,3,4-tetrahydroacridin-1-ol-d3
Deuterated research compound
Pyrazine-2,5-dicarboxylic acid
research compound
Tert-Butyldicyclohexylphosphonium tetrafluoroborate
phosphine ligand precursor
2-(2-Fluorophenyl)-3H-imidazo[4,5-c]pyridine methanesulfonate
research compound
2,3,4,5-tetradeuterio-6-ethoxycarbonylbenzoic acid
YWWHKOHZGJFMIE-LNFUJOGGSA-N
[2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCC)[2H])[2H]