Triphenylacetic acid is a research chemical consisting of a carboxylic acid group attached to a central carbon bearing three phenyl rings. It is commonly used as a laboratory reagent in organic synthesis and chemical research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 595-91-5
2-Butanone, 3-chloro-3-methyl-
chemical synthesis intermediate
D-Alanine tert-butyl ester hydrochloride
research compound
2-Azidoadenosine
research intermediate for adenosine analogs
Alpha-Naphtholphthalein
pH indicator
Rhodium(II) 2,2,2-triphenylacetate
research compound for catalysis
2,2,2-triphenylacetic acid
DCYGAPKNVCQNOE-UHFFFAOYSA-N
C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C(=O)O