2-Azidoadenosine is a chemical compound that serves as a research intermediate for the synthesis of adenosine analogs. It features an azido group attached to the purine ring, and its structure includes multiple alcohol and amine functional groups, making it a polar molecule suitable for biochemical studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 59587-07-4
(2R,3R,4S,5R)-2-(6-amino-2-azidopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol
BSZZPOARGMTJKQ-UUOKFMHZSA-N
C1=NC2=C(N=C(N=C2N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N=[N+]=[N-])N