(S)-3-Phenylpiperidine is a chiral piperidine derivative used as a pharmaceutical intermediate in the synthesis of active pharmaceutical ingredients. Its structure features an aromatic ring and a secondary amine, with a single stereocenter that defines its specific three-dimensional arrangement.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 59349-71-2
(R)-3-Phenyl-pyrrolidine hydrochloride
research compound
N-(4-Bromopentyl)phthalimide
pharmaceutical intermediate
1-[(tert-butoxy)carbonyl]pyrrolidine-3-carboxylic acid
Pharmaceutical intermediate for peptide synthesis
3-[(3R,4S)-3,4-dimethylpiperidin-4-yl]phenol
pharmaceutical intermediate
Methyl 2-methyl-3-nitrobenzoate
Pharmaceutical intermediate
3-Phenylpiperidine
Research compound
(R)-3-Phenylpiperidine
research compound
(R)-3-Phenylpiperidine hydrochloride
Pharmaceutical intermediate
(3S)-3-phenylpiperidine
NZYBILDYPCVNMU-LLVKDONJSA-N
C1C[C@H](CNC1)C2=CC=CC=C2