(R)-3-Phenylpiperidine hydrochloride is a chiral pharmaceutical intermediate used in the synthesis of active pharmaceutical ingredients. Its structure features a piperidine ring with a phenyl substituent in the (R)-configuration, and it is supplied as the hydrochloride salt.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 450416-58-7
(R)-3-Phenylpiperidine
research compound
(R)-3-Phenyl-pyrrolidine hydrochloride
research compound
5-Bromovaleryl chloride
Pharmaceutical intermediate
Ethyl 4-fluorobenzoate
pharmaceutical intermediate
(4S)-4-AMINO-5-(TERT-BUTOXY)-5-OXOPENTANOIC ACID
amino acid synthesis intermediate
Boc-N-methyl-L-valine
boc-protected amino acid intermediate
(S)-3-Phenylpiperidine
Pharmaceutical intermediate for synthesis
3-Phenylpiperidine
Research compound
(3R)-3-phenylpiperidine;hydrochloride
OKVMJYYCFLIGFJ-MERQFXBCSA-N
C1C[C@@H](CNC1)C2=CC=CC=C2.Cl