(R)-1-(4-nitrophenyl)ethanol is a research compound with a molecular structure featuring an aromatic ring, an alcohol group, and a nitro group. It is a chiral molecule with defined stereochemistry, commonly used as a laboratory reagent or intermediate in chemical synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 58287-18-6
1-BROMO-2-IODOBENZENE
organic synthesis research reagent
4-(tert-Butyl)-2-(2,4-difluorophenyl)pyridine
research compound
Tetramethylammonium bicarbonate
Research reagent for organic synthesis
Dimethyl 3,4-dihydroxythiophene-2,5-dicarboxylate
research compound
(1R)-1-(4-nitrophenyl)ethanol
CRJFHXYELTYDSG-ZCFIWIBFSA-N
C[C@H](C1=CC=C(C=C1)[N+](=O)[O-])O