This compound is a chiral carboxylic acid that serves as a key building block in the synthesis of certain pyrethroid insecticides. Its structure features a cyclopropane ring with dichloroethenyl and carboxylic acid substituents, characteristic of a common synthetic intermediate.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 55701-03-6
(1R-trans)-3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride
pyrethroid insecticide intermediate
3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride
Pyrethroid insecticide intermediate
Methyl 2,4-dichlorobenzeneacetate
agrochemical intermediate
Methyl 3-(4-hydroxyphenyl)propionate
nitrification inhibitor and plant growth regulator
Parathion
Insecticide and acaricide
Ethion
Organophosphate insecticide and acaricide
Cis-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropane carboxylic acid
certified reference standard
Cis-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropane carboxylic acid
Pyrethroid insecticide intermediate
cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid
LLMLSUSAKZVFOA-XINAWCOVSA-N
CC1([C@@H]([C@H]1C(=O)O)C=C(Cl)Cl)C