This compound is a cyclopropanecarboxylic acid derivative used as an intermediate in the synthesis of pyrethroid insecticides. Its structure includes a dichloroethenyl side chain and a single carboxylic acid group, conferring properties relevant to agrochemical manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 59042-49-8
Cis-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropane carboxylic acid
certified reference standard
(1R-trans)-3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride
pyrethroid insecticide intermediate
3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride
Pyrethroid insecticide intermediate
Terbuthylazine
broad-spectrum herbicide for crops
(1E)-(Pent-1-en-1-yl)boronic acid
agrochemical intermediate
1-Triacontanol
plant growth regulator
Larvin
carbamate insecticide and molluscicide
1R-cis-Permethrinic acid
pharmaceutical intermediate
trans-(1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid
LLMLSUSAKZVFOA-INEUFUBQSA-N
CC1([C@@H]([C@@H]1C(=O)O)C=C(Cl)Cl)C